![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 The Shining Hour.mp3 | 2007-01-28 02:14 | 8.9M | |
| 02 Jupiter and Teardrop.mp3 | 2007-01-28 02:14 | 14M | |
| 03 Fuzzy.mp3 | 2007-01-28 02:14 | 11M | |
| 04 Wish You Well.mp3 | 2007-01-28 02:14 | 8.0M | |
| 05 The Hook.mp3 | 2007-01-28 02:14 | 9.7M | |
| 06 Soft Wolf Tread.mp3 | 2007-01-28 02:14 | 6.6M | |
| 07 Stars N' Stripes.mp3 | 2007-01-28 02:14 | 11M | |
| 08 Dixie Drug Store.mp3 | 2007-01-28 02:14 | 12M | |
| 09 America Snoring.mp3 | 2007-01-28 02:14 | 8.4M | |
| 10 Grace.mp3 | 2007-01-28 02:14 | 14M | |
| 11 You Just Have to Be Crazy.mp3 | 2007-01-28 02:14 | 8.3M | |
| AlbumArtSmall.jpg | 2007-01-09 07:12 | 2.7K | |
| AlbumArt_{B260182C-52D4-48E7-8681-626B0FCFF173}_Large.jpg | 2007-01-09 07:12 | 9.6K | |
| AlbumArt_{B260182C-52D4-48E7-8681-626B0FCFF173}_Small.jpg | 2007-01-09 07:12 | 2.7K | |
| Folder.jpg | 2007-01-09 07:12 | 9.6K | |
