![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| The Beautiful Lie.jpg | 2008-04-07 02:02 | 3.2K | |
| 14-Good Friends Are Hard To Find.mp3 | 2008-04-07 02:01 | 5.3M | |
| 13-Braille.mp3 | 2008-04-07 02:01 | 7.6M | |
| 12-I Am The Drug.mp3 | 2008-04-07 02:01 | 4.8M | |
| 11-The Pristine Claw.mp3 | 2008-04-07 02:01 | 4.6M | |
| 10-Rain On The Pretty Ones.mp3 | 2008-04-07 02:01 | 5.9M | |
| 09-Scatterbraine.mp3 | 2008-04-07 02:01 | 3.8M | |
| 08-Until Tomorrow Then.mp3 | 2008-04-07 02:01 | 5.4M | |
| 07-Revolution In The Heart.mp3 | 2008-04-07 02:01 | 6.0M | |
| 06-Late Night Partner.mp3 | 2008-04-07 02:01 | 6.3M | |
| 05-Shadowboxing.mp3 | 2008-04-07 02:01 | 4.6M | |
| 04-The Last Cigarette.mp3 | 2008-04-07 02:01 | 4.8M | |
| 03-You Only Call Me When You're Drunk.mp3 | 2008-04-07 02:01 | 6.1M | |
| 02-Visit From The Dead Dog.mp3 | 2008-04-07 02:01 | 4.1M | |
| 01-Whirlwind In D-Minor.mp3 | 2008-04-07 02:01 | 5.4M | |